CAS 86398-53-0 is the registry number for Denatonium Benzoate Hydrate. Offered by: TRC. Available pack sizes: 100mg.
Benzyl-[2-(2,6-dimethylanilino)-2-oxoethyl]-diethylazanium;benzoate;hydrate (CAS 86398-53-0) is a chemical compound with the molecular formula C28H36N2O4 and a molecular weight of 464.6 g/mol. IUPAC name: benzyl-[2-(2,6-dimethylanilino)-2-oxoethyl]-diethylazanium;benzoate;hydrate. InChIKey: YYMVPVZYUYQSJE-UHFFFAOYSA-N.
| Molecular formula | C28H36N2O4 |
|---|---|
| Molecular weight | 464.6 g/mol |
| IUPAC name | benzyl-[2-(2,6-dimethylanilino)-2-oxoethyl]-diethylazanium;benzoate;hydrate |
| InChIKey | YYMVPVZYUYQSJE-UHFFFAOYSA-N |
| SMILES | CC[N+](CC)(CC1=CC=CC=C1)CC(=O)NC2=C(C=CC=C2C)C.C1=CC=C(C=C1)C(=O)[O-].O |
Computed by PubChem (NCBI)