CAS 864-23-3 appears in our catalog under these names: 1H,1H,9H-Perfluorononyl p-toluenesulfonate, 95%, 1H,1h,9h-perfluorononylp-toluenesulfonate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 100g, 1g.
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononyl 4-methylbenzenesulfonate (CAS 864-23-3) is a chemical compound with the molecular formula C16H10F16O3S and a molecular weight of 586.3 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononyl 4-methylbenzenesulfonate. InChIKey: PMXVBJFBLLGPKO-UHFFFAOYSA-N.
| Molecular formula | C16H10F16O3S |
|---|---|
| Molecular weight | 586.3 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononyl 4-methylbenzenesulfonate |
| InChIKey | PMXVBJFBLLGPKO-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCC(C(C(C(C(C(C(C(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)