CAS 864070-19-9 is the registry number for (4-(5-Bromo-2-chlorobenzyl)phenoxy)(tert-butyl)dimethylsilane, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[4-[(5-bromo-2-chlorophenyl)methyl]phenoxy]-tert-butyl-dimethylsilane (CAS 864070-19-9) is a chemical compound with the molecular formula C19H24BrClOSi and a molecular weight of 411.8 g/mol. IUPAC name: [4-[(5-bromo-2-chlorophenyl)methyl]phenoxy]-tert-butyl-dimethylsilane. InChIKey: DGZRKOVWOYLOAW-UHFFFAOYSA-N.
| Molecular formula | C19H24BrClOSi |
|---|---|
| Molecular weight | 411.8 g/mol |
| IUPAC name | [4-[(5-bromo-2-chlorophenyl)methyl]phenoxy]-tert-butyl-dimethylsilane |
| InChIKey | DGZRKOVWOYLOAW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1=CC=C(C=C1)CC2=C(C=CC(=C2)Br)Cl |
Computed by PubChem (NCBI)