CAS 864070-37-1 appears in our catalog under these names: SGLT2-IN-1, 99.82%, SGLT2-IN-1 (Standard), Dapagliflozin Impurity 22, Dapagliflozin Impurity 16, Empagliflozin Impurity 3. Offered by: MedChemExpress, Chemat Brand, TRC, GLPBio, TargetMol. Available pack sizes: 25 mg, 100 mg, 5 mg, 50 mg, 10mM/1mL, 10 mg, Get quote, on request.
(2S,3R,4R,5S,6R)-2-[4-chloro-3-[(4-hydroxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (CAS 864070-37-1) is a chemical compound with the molecular formula C19H21ClO6 and a molecular weight of 380.8 g/mol. IUPAC name: (2S,3R,4R,5S,6R)-2-[4-chloro-3-[(4-hydroxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol. InChIKey: ODQAIMBPQWETBE-FQBWVUSXSA-N.
| Molecular formula | C19H21ClO6 |
|---|---|
| Molecular weight | 380.8 g/mol |
| IUPAC name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[(4-hydroxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| InChIKey | ODQAIMBPQWETBE-FQBWVUSXSA-N |
| SMILES | C1=CC(=CC=C1CC2=C(C=CC(=C2)[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)Cl)O |
Computed by PubChem (NCBI)