CAS 864071-08-9 is the registry number for Perfluorooctanoic Acid-13C2 (PFOA-13C2). Offered by: Chemat Brand. Available pack sizes: on request.
2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro(1,2-13C2)octanoic acid (CAS 864071-08-9) is a chemical compound with the molecular formula C8HF15O2 and a molecular weight of 416.05 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro(1,2-13C2)octanoic acid. InChIKey: SNGREZUHAYWORS-ZDOIIHCHSA-N.
| Molecular formula | C8HF15O2 |
|---|---|
| Molecular weight | 416.05 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro(1,2-13C2)octanoic acid |
| InChIKey | SNGREZUHAYWORS-ZDOIIHCHSA-N |
| SMILES | [13C](=O)([13C](C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O |
Computed by PubChem (NCBI)