Products 864071-08-9

CAS 864071-08-9 is the registry number for Perfluorooctanoic Acid-13C2 (PFOA-13C2). Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro(1,2-13C2)octanoic acid (CAS 864071-08-9) is a chemical compound with the molecular formula C8HF15O2 and a molecular weight of 416.05 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro(1,2-13C2)octanoic acid. InChIKey: SNGREZUHAYWORS-ZDOIIHCHSA-N.

Identity
Molecular formulaC8HF15O2
Molecular weight416.05 g/mol
IUPAC name2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro(1,2-13C2)octanoic acid
InChIKeySNGREZUHAYWORS-ZDOIIHCHSA-N
SMILES[13C](=O)([13C](C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O

Computed by PubChem (NCBI)