CAS 86408-72-2 appears in our catalog under these names: Ecabet sodium, 98%, Ecabet Sodium, Ecabet sodium, 99%, Ecabet Sodium/ 97.68% (existing batch purity), Ecabet (sodium salt). Offered by: Combi-blocks, Chemat Brand, AmBeed, TargetMol, GLPBio. Available pack sizes: 25g, 5g, 100g, 10g, 1g, on request, 25mg, 50mg.
Sodium (4bS,8R,8aR)-8-carboxy-4b,8-dimethyl-2-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthrene-3-sulfonate (CAS 86408-72-2) is a chemical compound with the molecular formula C20H27NaO5S and a molecular weight of 402.5 g/mol. IUPAC name: sodium (4bS,8R,8aR)-8-carboxy-4b,8-dimethyl-2-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthrene-3-sulfonate. InChIKey: RCVIHORGZULVTN-YGJXXQMASA-M.
| Molecular formula | C20H27NaO5S |
|---|---|
| Molecular weight | 402.5 g/mol |
| IUPAC name | sodium (4bS,8R,8aR)-8-carboxy-4b,8-dimethyl-2-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthrene-3-sulfonate |
| InChIKey | RCVIHORGZULVTN-YGJXXQMASA-M |
| SMILES | CC(C)C1=C(C=C2C(=C1)CC[C@@H]3[C@@]2(CCC[C@@]3(C)C(=O)O)C)S(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)