CAS 864085-92-7 appears in our catalog under these names: MDNI-caged-L-glutamate, MDNI–caged–L–glutamate. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 250mg, 10mg, Get quote.
(2S)-2-amino-5-(4-methoxy-5,7-dinitro-2,3-dihydroindol-1-yl)-5-oxopentanoic acid (CAS 864085-92-7) is a chemical compound with the molecular formula C14H16N4O8 and a molecular weight of 368.30 g/mol. IUPAC name: (2S)-2-amino-5-(4-methoxy-5,7-dinitro-2,3-dihydroindol-1-yl)-5-oxopentanoic acid. InChIKey: SYNWQVVPBORTQE-QMMMGPOBSA-N.
| Molecular formula | C14H16N4O8 |
|---|---|
| Molecular weight | 368.30 g/mol |
| IUPAC name | (2S)-2-amino-5-(4-methoxy-5,7-dinitro-2,3-dihydroindol-1-yl)-5-oxopentanoic acid |
| InChIKey | SYNWQVVPBORTQE-QMMMGPOBSA-N |
| SMILES | COC1=C(C=C(C2=C1CCN2C(=O)CC[C@@H](C(=O)O)N)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)