CAS 86419-69-4 appears in our catalog under these names: N1-(5-Methoxy-2-nitrophenyl)-1,2-ethanediamine hydrochloride, 95%, 95%, N1-(5-Methoxy-2-nitrophenyl)ethane-1,2-diamine hydrochloride, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g.
N'-(5-methoxy-2-nitrophenyl)ethane-1,2-diamine;hydrochloride (CAS 86419-69-4) is a chemical compound with the molecular formula C9H14ClN3O3 and a molecular weight of 247.68 g/mol. IUPAC name: N'-(5-methoxy-2-nitrophenyl)ethane-1,2-diamine;hydrochloride. InChIKey: AFAJYBYVKUTWJK-UHFFFAOYSA-N.
| Molecular formula | C9H14ClN3O3 |
|---|---|
| Molecular weight | 247.68 g/mol |
| IUPAC name | N'-(5-methoxy-2-nitrophenyl)ethane-1,2-diamine;hydrochloride |
| InChIKey | AFAJYBYVKUTWJK-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)[N+](=O)[O-])NCCN.Cl |
Computed by PubChem (NCBI)