CAS 864235-83-6 appears in our catalog under these names: Fmoc-nh-ethyl-ss-propionic acid, 95%, Fmoc-NH-ethyl-SS-propionic acid, Fmoc–NH–ethyl–SS–propionic acid, Fmoc-SS-COOH, Fmoc-NH-ethyl-SS-propionic acid 98%. Offered by: Combi-blocks, TargetMol, GLPBio, Iris Biotech, Ambeed. Available pack sizes: 250mg, 100mg, 2mg, 1g, 5g, 25 mg, 100 mg, 50 mg.
3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyldisulfanyl]propanoic acid (CAS 864235-83-6) is a chemical compound with the molecular formula C20H21NO4S2 and a molecular weight of 403.5 g/mol. IUPAC name: 3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyldisulfanyl]propanoic acid. InChIKey: FXHUKQIBGGQHPZ-UHFFFAOYSA-N.
| Molecular formula | C20H21NO4S2 |
|---|---|
| Molecular weight | 403.5 g/mol |
| IUPAC name | 3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyldisulfanyl]propanoic acid |
| InChIKey | FXHUKQIBGGQHPZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCSSCCC(=O)O |
Computed by PubChem (NCBI)