CAS 86426-17-7 appears in our catalog under these names: Mildronate dihydrate, 95%, Mildronate Dihydrate, 3-(1,1,1-Trimethylhydrazin-1-ium-2-yl)propanoate Dihydrate, >95% (HPLC), Mildronate (hydrate), Meldonium dihydrate - Bio-X â„¢. Offered by: Combi-blocks, Chemat Brand, TRC, GLPBio, TargetMol. Available pack sizes: 100g, 1g, 5g, 25g, on request, 2,5g, 10mg, 100mg.
3-[(trimethylazaniumyl)amino]propanoate;dihydrate (CAS 86426-17-7) is a chemical compound with the molecular formula C6H18N2O4 and a molecular weight of 182.22 g/mol. IUPAC name: 3-[(trimethylazaniumyl)amino]propanoate;dihydrate. InChIKey: JFWLFLLRLZSBRA-UHFFFAOYSA-N.
| Molecular formula | C6H18N2O4 |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | 3-[(trimethylazaniumyl)amino]propanoate;dihydrate |
| InChIKey | JFWLFLLRLZSBRA-UHFFFAOYSA-N |
| SMILES | C[N+](C)(C)NCCC(=O)[O-].O.O |
Computed by PubChem (NCBI)