CAS 864263-03-6 is the registry number for (4-(3-Fluorophenoxy)phenyl)methanamine. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
[4-(3-fluorophenoxy)phenyl]methanamine (CAS 864263-03-6) is a chemical compound with the molecular formula C13H12FNO and a molecular weight of 217.24 g/mol. IUPAC name: [4-(3-fluorophenoxy)phenyl]methanamine. InChIKey: LIOGVDBYTRYBOL-UHFFFAOYSA-N.
| Molecular formula | C13H12FNO |
|---|---|
| Molecular weight | 217.24 g/mol |
| IUPAC name | [4-(3-fluorophenoxy)phenyl]methanamine |
| InChIKey | LIOGVDBYTRYBOL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)OC2=CC=C(C=C2)CN |
Computed by PubChem (NCBI)