Products 864443-43-6
CAS 864443-43-6 is the registry number for Anticancer agent 118. Offered by: MedChemExpress. Available pack sizes: Get quote.
7-[4-(2-chloroacetyl)piperazin-1-yl]-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylic acid (CAS 864443-43-6) is a chemical compound with the molecular formula C19H19ClFN3O4 and a molecular weight of 407.8 g/mol. IUPAC name: 7-[4-(2-chloroacetyl)piperazin-1-yl]-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylic acid. InChIKey: AGTFKGLDCMHYMV-UHFFFAOYSA-N.
| Molecular formula | C19H19ClFN3O4 |
|---|---|
| Molecular weight | 407.8 g/mol |
| IUPAC name | 7-[4-(2-chloroacetyl)piperazin-1-yl]-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylic acid |
| InChIKey | AGTFKGLDCMHYMV-UHFFFAOYSA-N |
| SMILES | C1CC1N2C=C(C(=O)C3=CC(=C(C=C32)N4CCN(CC4)C(=O)CCl)F)C(=O)O |
Computed by PubChem (NCBI)