CAS 864528-33-6 appears in our catalog under these names: 3-(Azidomethyl)pyridine, 97%, 97%, 3-(azidomethyl)pyridine, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
3-(azidomethyl)pyridine (CAS 864528-33-6) is a chemical compound with the molecular formula C6H6N4 and a molecular weight of 134.14 g/mol. IUPAC name: 3-(azidomethyl)pyridine. InChIKey: PPHVFMDULQHSTJ-UHFFFAOYSA-N.
| Molecular formula | C6H6N4 |
|---|---|
| Molecular weight | 134.14 g/mol |
| IUPAC name | 3-(azidomethyl)pyridine |
| InChIKey | PPHVFMDULQHSTJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)CN=[N+]=[N-] |
Computed by PubChem (NCBI)