Products 86453-15-8

CAS 86453-15-8 is the registry number for [(1,1-Dioxidotetrahydrothien-3-yl)thio]acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

2-(1,1-dioxothiolan-3-yl)sulfanylacetic acid (CAS 86453-15-8) is a chemical compound with the molecular formula C6H10O4S2 and a molecular weight of 210.3 g/mol. IUPAC name: 2-(1,1-dioxothiolan-3-yl)sulfanylacetic acid. InChIKey: AJTOTGKRRDVGAK-UHFFFAOYSA-N.

Identity
Molecular formulaC6H10O4S2
Molecular weight210.3 g/mol
IUPAC name2-(1,1-dioxothiolan-3-yl)sulfanylacetic acid
InChIKeyAJTOTGKRRDVGAK-UHFFFAOYSA-N
SMILESC1CS(=O)(=O)CC1SCC(=O)O

Computed by PubChem (NCBI)