CAS 864685-26-7 is the registry number for tert-Butyl 5-cyano-3-iodo-1H-indole-1-carboxylate, 98%. Offered by: Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g.
Tert-butyl 5-cyano-3-iodoindole-1-carboxylate (CAS 864685-26-7) is a chemical compound with the molecular formula C14H13IN2O2 and a molecular weight of 368.17 g/mol. IUPAC name: tert-butyl 5-cyano-3-iodoindole-1-carboxylate. InChIKey: GADLXNFRAAUWAD-UHFFFAOYSA-N.
| Molecular formula | C14H13IN2O2 |
|---|---|
| Molecular weight | 368.17 g/mol |
| IUPAC name | tert-butyl 5-cyano-3-iodoindole-1-carboxylate |
| InChIKey | GADLXNFRAAUWAD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C2=C1C=CC(=C2)C#N)I |
Computed by PubChem (NCBI)