CAS 864716-85-8 appears in our catalog under these names: Mesendogen, 98%, Mesendogen/ 98.9% (existing batch purity), Mesendogen, N-({(2-Chloro-5-(trifluoromethyl) phenyl)amino}carbonothioyl)-4-isopropylbenzamide, Mesendogen 98%. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 250mg, 50 mg.
N-[[2-chloro-5-(trifluoromethyl)phenyl]carbamothioyl]-4-propan-2-ylbenzamide (CAS 864716-85-8) is a chemical compound with the molecular formula C18H16ClF3N2OS and a molecular weight of 400.8 g/mol. IUPAC name: N-[[2-chloro-5-(trifluoromethyl)phenyl]carbamothioyl]-4-propan-2-ylbenzamide. InChIKey: VVFIVYCBLSSVEK-UHFFFAOYSA-N.
| Molecular formula | C18H16ClF3N2OS |
|---|---|
| Molecular weight | 400.8 g/mol |
| IUPAC name | N-[[2-chloro-5-(trifluoromethyl)phenyl]carbamothioyl]-4-propan-2-ylbenzamide |
| InChIKey | VVFIVYCBLSSVEK-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)C(=O)NC(=S)NC2=C(C=CC(=C2)C(F)(F)F)Cl |
Computed by PubChem (NCBI)