Products 864741-95-7
CAS 864741-95-7 appears in our catalog under these names: Sb 699551 dihydrochloride, 95%, SB 699551 Dihydrochloride, SB 699551 dihydrochloride/ 96.53% (existing batch purity), SB 699551, Sb 699551, 98%, 98%. Offered by: Combi-blocks, TRC, TargetMol, GLPBio, Chemat. Available pack sizes: 10mg, 5mg, 25mg, 100mg, 1mg, 50mg, 10mM (in 1ml dmso), 25 mg.
3-cyclopentyl-N-[2-(dimethylamino)ethyl]-N-[[4-[4-[(2-phenylethylamino)methyl]phenyl]phenyl]methyl]propanamide;dihydrochloride (CAS 864741-95-7) is a chemical compound with the molecular formula C34H47Cl2N3O and a molecular weight of 584.7 g/mol. IUPAC name: 3-cyclopentyl-N-[2-(dimethylamino)ethyl]-N-[[4-[4-[(2-phenylethylamino)methyl]phenyl]phenyl]methyl]propanamide;dihydrochloride. InChIKey: QJMKBIHLMPTYTI-UHFFFAOYSA-N.
| Molecular formula | C34H47Cl2N3O |
|---|---|
| Molecular weight | 584.7 g/mol |
| IUPAC name | 3-cyclopentyl-N-[2-(dimethylamino)ethyl]-N-[[4-[4-[(2-phenylethylamino)methyl]phenyl]phenyl]methyl]propanamide;dihydrochloride |
| InChIKey | QJMKBIHLMPTYTI-UHFFFAOYSA-N |
| SMILES | CN(C)CCN(CC1=CC=C(C=C1)C2=CC=C(C=C2)CNCCC3=CC=CC=C3)C(=O)CCC4CCCC4.Cl.Cl |
Computed by PubChem (NCBI)