Products 86480-27-5

CAS 86480-27-5 is the registry number for Dopexamine Impurity 8 (Dopexamine EP Impurity H). Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

N'-[2-(3,4-dimethoxyphenyl)ethyl]-N-(2-phenylethyl)hexane-1,6-diamine (CAS 86480-27-5) is a chemical compound with the molecular formula C24H36N2O2 and a molecular weight of 384.6 g/mol. IUPAC name: N'-[2-(3,4-dimethoxyphenyl)ethyl]-N-(2-phenylethyl)hexane-1,6-diamine. InChIKey: PRLFIKKGRPLYBY-UHFFFAOYSA-N.

Identity
Molecular formulaC24H36N2O2
Molecular weight384.6 g/mol
IUPAC nameN'-[2-(3,4-dimethoxyphenyl)ethyl]-N-(2-phenylethyl)hexane-1,6-diamine
InChIKeyPRLFIKKGRPLYBY-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)CCNCCCCCCNCCC2=CC=CC=C2)OC

Computed by PubChem (NCBI)