CAS 864864-86-8 appears in our catalog under these names: DFMTI, 98+%, DFMTI (MK5435), 5-[1-(2,4-difluorophenyl)-5-methyltriazol-4-yl]-2-propan-2-yl-3H-isoindol-1-one, 99.04%, 99.04%, DFMTI, 99.04%, DFMTI (Standard). Offered by: AmBeed, GLPBio, Chemat, MedChemExpress. Available pack sizes: 100mg, 1mg, 10mg, 10mM (in 1ml dmso), 5mg, 50mg, 50 mg, 10 mg.
5-[1-(2,4-difluorophenyl)-5-methyltriazol-4-yl]-2-propan-2-yl-3H-isoindol-1-one (CAS 864864-86-8) is a chemical compound with the molecular formula C20H18F2N4O and a molecular weight of 368.4 g/mol. IUPAC name: 5-[1-(2,4-difluorophenyl)-5-methyltriazol-4-yl]-2-propan-2-yl-3H-isoindol-1-one. InChIKey: KKZVYGIANGOHBS-UHFFFAOYSA-N.
| Molecular formula | C20H18F2N4O |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | 5-[1-(2,4-difluorophenyl)-5-methyltriazol-4-yl]-2-propan-2-yl-3H-isoindol-1-one |
| InChIKey | KKZVYGIANGOHBS-UHFFFAOYSA-N |
| SMILES | CC1=C(N=NN1C2=C(C=C(C=C2)F)F)C3=CC4=C(C=C3)C(=O)N(C4)C(C)C |
Computed by PubChem (NCBI)