Products 864873-81-4
CAS 864873-81-4 is the registry number for KMUP-4. Offered by: MedChemExpress. Available pack sizes: Get quote.
1,3-dimethyl-7-[2-[4-(2-nitrophenyl)piperazin-1-yl]ethyl]purine-2,6-dione (CAS 864873-81-4) is a chemical compound with the molecular formula C19H23N7O4 and a molecular weight of 413.4 g/mol. IUPAC name: 1,3-dimethyl-7-[2-[4-(2-nitrophenyl)piperazin-1-yl]ethyl]purine-2,6-dione. InChIKey: GHCXHWXSBNBFPF-UHFFFAOYSA-N.
| Molecular formula | C19H23N7O4 |
|---|---|
| Molecular weight | 413.4 g/mol |
| IUPAC name | 1,3-dimethyl-7-[2-[4-(2-nitrophenyl)piperazin-1-yl]ethyl]purine-2,6-dione |
| InChIKey | GHCXHWXSBNBFPF-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=O)N(C1=O)C)N(C=N2)CCN3CCN(CC3)C4=CC=CC=C4[N+](=O)[O-] |
Computed by PubChem (NCBI)