CAS 865-77-0 is the registry number for Perfluoroisononyl iodide, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
1,1,1,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluoro-8-iodo-2-(trifluoromethyl)octane (CAS 865-77-0) is a chemical compound with the molecular formula C9F19I and a molecular weight of 595.97 g/mol. IUPAC name: 1,1,1,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluoro-8-iodo-2-(trifluoromethyl)octane. InChIKey: VRJGWRPPKVEMMR-UHFFFAOYSA-N.
| Molecular formula | C9F19I |
|---|---|
| Molecular weight | 595.97 g/mol |
| IUPAC name | 1,1,1,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluoro-8-iodo-2-(trifluoromethyl)octane |
| InChIKey | VRJGWRPPKVEMMR-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(C(C(F)(F)I)(F)F)(F)F)(F)F)(F)F)(F)F)(C(F)(F)F)(C(F)(F)F)F |
Computed by PubChem (NCBI)