CAS 865-86-1 appears in our catalog under these names: 1H,1H,2H,2H-Perfluorododecan-1-ol, 1H,1H,2H,2H-Perfluoro-1-dodecanol, 1H,1H,2H,2H-Perfluorododecan-1-ol, 97%, 1,1,2,2-Tetrahydroperfluoro dodecanol, 2-(Perfluorodecyl)ethanol, ROTI®Star, 100 mg, glass. Offered by: TRC, Dr. Ehrenstorfer, Sigma-Aldrich, HPC Standards, Combi-blocks. Available pack sizes: 1g, 250mg, 25mg, 100mg, 1x100mg, 5g, 10g.
3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluorododecan-1-ol (CAS 865-86-1) is a chemical compound with the molecular formula C12H5F21O and a molecular weight of 564.13 g/mol. IUPAC name: 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluorododecan-1-ol. InChIKey: FLXYIZWPNQYPIT-UHFFFAOYSA-N.
| Molecular formula | C12H5F21O |
|---|---|
| Molecular weight | 564.13 g/mol |
| IUPAC name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluorododecan-1-ol |
| InChIKey | FLXYIZWPNQYPIT-UHFFFAOYSA-N |
| SMILES | C(CO)C(C(C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)