Products 865101-22-0
CAS 865101-22-0 is the registry number for PXYC2. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[(6-oxo-1,7-dihydropurin-2-yl)sulfanyl]acetic acid (CAS 865101-22-0) is a chemical compound with the molecular formula C7H6N4O3S and a molecular weight of 226.22 g/mol. IUPAC name: 2-[(6-oxo-1,7-dihydropurin-2-yl)sulfanyl]acetic acid. InChIKey: MGMKXTOVQNCAQM-UHFFFAOYSA-N.
| Molecular formula | C7H6N4O3S |
|---|---|
| Molecular weight | 226.22 g/mol |
| IUPAC name | 2-[(6-oxo-1,7-dihydropurin-2-yl)sulfanyl]acetic acid |
| InChIKey | MGMKXTOVQNCAQM-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(N1)C(=O)NC(=N2)SCC(=O)O |
Computed by PubChem (NCBI)