CAS 865149-76-4 is the registry number for 2–Chloro–6–(difluoromethoxy)aniline. Offered by: GLPBio. Available pack sizes: 100mg.
2-chloro-6-(difluoromethoxy)aniline (CAS 865149-76-4) is a chemical compound with the molecular formula C7H6ClF2NO and a molecular weight of 193.58 g/mol. IUPAC name: 2-chloro-6-(difluoromethoxy)aniline. InChIKey: MTIWWUWDZARWTH-UHFFFAOYSA-N.
| Molecular formula | C7H6ClF2NO |
|---|---|
| Molecular weight | 193.58 g/mol |
| IUPAC name | 2-chloro-6-(difluoromethoxy)aniline |
| InChIKey | MTIWWUWDZARWTH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)N)OC(F)F |
Computed by PubChem (NCBI)