CAS 865373-66-6 is the registry number for 2,4-Dioxo-2,3,4,5-tetrahydro-1H-benzo(b)(1,4)diazepine-7-sulfonyl chloride, 97%. Offered by: AmBeed. Available pack sizes: 1g.
2,4-dioxo-1,5-dihydro-1,5-benzodiazepine-7-sulfonyl chloride (CAS 865373-66-6) is a chemical compound with the molecular formula C9H7ClN2O4S and a molecular weight of 274.68 g/mol. IUPAC name: 2,4-dioxo-1,5-dihydro-1,5-benzodiazepine-7-sulfonyl chloride. InChIKey: FOMGZBPQPAFTHP-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O4S |
|---|---|
| Molecular weight | 274.68 g/mol |
| IUPAC name | 2,4-dioxo-1,5-dihydro-1,5-benzodiazepine-7-sulfonyl chloride |
| InChIKey | FOMGZBPQPAFTHP-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(C=C(C=C2)S(=O)(=O)Cl)NC1=O |
Computed by PubChem (NCBI)