CAS 865625-56-5 appears in our catalog under these names: Ladarixin sodium, Ladarixin Sodium, Ladarixin sodium, 95+%, Sodium (R)-(methylsulfonyl)(2-(4-(((trifluoromethyl)sulfonyl)oxy)phenyl)propanoyl)amide, 99%, 99%, Ladarixin (sodium), 99.84%. Offered by: GLPBio, TRC, AmBeed, TargetMol, Biosynth. Available pack sizes: 5mg, 100mg, 1g, 250mg, 1mg, 10mg, 25mg, 10mM (in 1ml dmso).
Sodium methylsulfonyl-[(2R)-2-[4-(trifluoromethylsulfonyloxy)phenyl]propanoyl]azanide (CAS 865625-56-5) is a chemical compound with the molecular formula C11H11F3NNaO6S2 and a molecular weight of 397.3 g/mol. IUPAC name: sodium methylsulfonyl-[(2R)-2-[4-(trifluoromethylsulfonyloxy)phenyl]propanoyl]azanide. InChIKey: QICAUCDBOAKDNS-OGFXRTJISA-M.
| Molecular formula | C11H11F3NNaO6S2 |
|---|---|
| Molecular weight | 397.3 g/mol |
| IUPAC name | sodium methylsulfonyl-[(2R)-2-[4-(trifluoromethylsulfonyloxy)phenyl]propanoyl]azanide |
| InChIKey | QICAUCDBOAKDNS-OGFXRTJISA-M |
| SMILES | C[C@H](C1=CC=C(C=C1)OS(=O)(=O)C(F)(F)F)C(=O)[N-]S(=O)(=O)C.[Na+] |
Computed by PubChem (NCBI)