CAS 865678-67-7 is the registry number for rac-PTC 299. Offered by: TRC. Available pack sizes: 500mg.
(4-chlorophenyl) 6-chloro-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (CAS 865678-67-7) is a chemical compound with the molecular formula C25H20Cl2N2O3 and a molecular weight of 467.3 g/mol. IUPAC name: (4-chlorophenyl) 6-chloro-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate. InChIKey: SRSHBZRURUNOSM-UHFFFAOYSA-N.
| Molecular formula | C25H20Cl2N2O3 |
|---|---|
| Molecular weight | 467.3 g/mol |
| IUPAC name | (4-chlorophenyl) 6-chloro-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| InChIKey | SRSHBZRURUNOSM-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2C3=C(CCN2C(=O)OC4=CC=C(C=C4)Cl)C5=C(N3)C=CC(=C5)Cl |
Computed by PubChem (NCBI)