CAS 865758-95-8 is the registry number for Alogliptin Related Compound 27. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(6-chloro-2,4-dioxopyrimidin-1-yl)methyl]benzonitrile (CAS 865758-95-8) is a chemical compound with the molecular formula C12H8ClN3O2 and a molecular weight of 261.66 g/mol. IUPAC name: 2-[(6-chloro-2,4-dioxopyrimidin-1-yl)methyl]benzonitrile. InChIKey: JASGBRKRMPRRTD-UHFFFAOYSA-N.
| Molecular formula | C12H8ClN3O2 |
|---|---|
| Molecular weight | 261.66 g/mol |
| IUPAC name | 2-[(6-chloro-2,4-dioxopyrimidin-1-yl)methyl]benzonitrile |
| InChIKey | JASGBRKRMPRRTD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CN2C(=CC(=O)NC2=O)Cl)C#N |
Computed by PubChem (NCBI)