CAS 865795-23-9 appears in our catalog under these names: Buntanetap L–Tartrate, Buntanetap (L-Tartrate), 98.93%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 100 mg, 10 mg, 25 mg, 50 mg, 5 mg.
[(3aS,8bR)-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl] N-phenylcarbamate;(2R,3R)-2,3-dihydroxybutanedioic acid (CAS 865795-23-9) is a chemical compound with the molecular formula C24H29N3O8 and a molecular weight of 487.5 g/mol. IUPAC name: [(3aS,8bR)-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl] N-phenylcarbamate;(2R,3R)-2,3-dihydroxybutanedioic acid. InChIKey: XKKPTCVQEJZDGT-WXJUTALTSA-N.
| Molecular formula | C24H29N3O8 |
|---|---|
| Molecular weight | 487.5 g/mol |
| IUPAC name | [(3aS,8bR)-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl] N-phenylcarbamate;(2R,3R)-2,3-dihydroxybutanedioic acid |
| InChIKey | XKKPTCVQEJZDGT-WXJUTALTSA-N |
| SMILES | C[C@]12CCN([C@H]1N(C3=C2C=C(C=C3)OC(=O)NC4=CC=CC=C4)C)C.[C@@H]([C@H](C(=O)O)O)(C(=O)O)O |
Computed by PubChem (NCBI)