CAS 865869-30-3 is the registry number for 4-(Trifluoromethyl)cyclohex-1-enylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
[4-(trifluoromethyl)cyclohexen-1-yl]boronic acid (CAS 865869-30-3) is a chemical compound with the molecular formula C7H10BF3O2 and a molecular weight of 193.96 g/mol. IUPAC name: [4-(trifluoromethyl)cyclohexen-1-yl]boronic acid. InChIKey: OCRVNCZKQNGCQI-UHFFFAOYSA-N.
| Molecular formula | C7H10BF3O2 |
|---|---|
| Molecular weight | 193.96 g/mol |
| IUPAC name | [4-(trifluoromethyl)cyclohexen-1-yl]boronic acid |
| InChIKey | OCRVNCZKQNGCQI-UHFFFAOYSA-N |
| SMILES | B(C1=CCC(CC1)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)