CAS 86587-72-6 is the registry number for 3-(1-Methylethyl)-2-phenyl-5-oxazolidinemethanol 5-(4-Methylbenzenesulfonate). Offered by: TRC. Available pack sizes: 1g, 2,5g, 5g.
(2-phenyl-3-propan-2-yl-1,3-oxazolidin-5-yl)methyl 4-methylbenzenesulfonate (CAS 86587-72-6) is a chemical compound with the molecular formula C20H25NO4S and a molecular weight of 375.5 g/mol. IUPAC name: (2-phenyl-3-propan-2-yl-1,3-oxazolidin-5-yl)methyl 4-methylbenzenesulfonate. InChIKey: NHPHEXHPXOZAHM-UHFFFAOYSA-N.
| Molecular formula | C20H25NO4S |
|---|---|
| Molecular weight | 375.5 g/mol |
| IUPAC name | (2-phenyl-3-propan-2-yl-1,3-oxazolidin-5-yl)methyl 4-methylbenzenesulfonate |
| InChIKey | NHPHEXHPXOZAHM-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCC2CN(C(O2)C3=CC=CC=C3)C(C)C |
Computed by PubChem (NCBI)