Products 865886-79-9
CAS 865886-79-9 appears in our catalog under these names: 5-bromo-4-nitro-2H-indazole-3-carboxylic acid, 97%, 5-bromo-4-nitro-1H-indazole-3-carboxylic acid, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 500mg.
5-bromo-4-nitro-1H-indazole-3-carboxylic acid (CAS 865886-79-9) is a chemical compound with the molecular formula C8H4BrN3O4 and a molecular weight of 286.04 g/mol. IUPAC name: 5-bromo-4-nitro-1H-indazole-3-carboxylic acid. InChIKey: OEUUOEMNVIKSLG-UHFFFAOYSA-N.
| Molecular formula | C8H4BrN3O4 |
|---|---|
| Molecular weight | 286.04 g/mol |
| IUPAC name | 5-bromo-4-nitro-1H-indazole-3-carboxylic acid |
| InChIKey | OEUUOEMNVIKSLG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1NN=C2C(=O)O)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)