CAS 866-17-1 appears in our catalog under these names: Sodiumdihydroxytartrate, 95%, Dihydroxytartaric Acid Disodium Salt. Offered by: Chemat Brand. Available pack sizes: on request.
Disodium;2,2,3,3-tetrahydroxybutanedioate (CAS 866-17-1) is a chemical compound with the molecular formula C4H4Na2O8 and a molecular weight of 226.05 g/mol. IUPAC name: disodium;2,2,3,3-tetrahydroxybutanedioate. InChIKey: JSKIAGGRMZDKAV-UHFFFAOYSA-L.
| Molecular formula | C4H4Na2O8 |
|---|---|
| Molecular weight | 226.05 g/mol |
| IUPAC name | disodium;2,2,3,3-tetrahydroxybutanedioate |
| InChIKey | JSKIAGGRMZDKAV-UHFFFAOYSA-L |
| SMILES | C(=O)(C(C(C(=O)[O-])(O)O)(O)O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)