CAS 866-97-7 appears in our catalog under these names: Tetrapentylammonium bromide, 98%, Tetrapentylammonium bromide, Tetraamylammonium Bromide, >98.0%(T), Tetrapentylammonium bromide, 99+%, TETRAPENTYLAMMONIUM BROMIDE, FOR IPC. Offered by: Combi-blocks, GLPBio, TCI, Thermo Scientific (Acros), Sigma-Aldrich. Available pack sizes: 5g, 25g, 1g, 10g, 100g, 10 g, 5 g.
Tetrapentylazanium bromide (CAS 866-97-7) is a chemical compound with the molecular formula C20H44BrN and a molecular weight of 378.5 g/mol. IUPAC name: tetrapentylazanium bromide. InChIKey: SPALIFXDWQTXKS-UHFFFAOYSA-M.
| Molecular formula | C20H44BrN |
|---|---|
| Molecular weight | 378.5 g/mol |
| IUPAC name | tetrapentylazanium bromide |
| InChIKey | SPALIFXDWQTXKS-UHFFFAOYSA-M |
| SMILES | CCCCC[N+](CCCCC)(CCCCC)CCCCC.[Br-] |
Computed by PubChem (NCBI)