CAS 866043-35-8 appears in our catalog under these names: 1-(4-Fluorobenzenesulfonyl)azetidine-3-carboxylic acid, 98%, 1-(4-fluorobenzenesulfonyl)azetidine-3-carboxylic acid, 98%, 98%, 1-((4-Fluorophenyl)sulfonyl)azetidine-3-carboxylic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 100mg, 250mg.
1-(4-fluorophenyl)sulfonylazetidine-3-carboxylic acid (CAS 866043-35-8) is a chemical compound with the molecular formula C10H10FNO4S and a molecular weight of 259.26 g/mol. IUPAC name: 1-(4-fluorophenyl)sulfonylazetidine-3-carboxylic acid. InChIKey: DIIBCOXATOTZJN-UHFFFAOYSA-N.
| Molecular formula | C10H10FNO4S |
|---|---|
| Molecular weight | 259.26 g/mol |
| IUPAC name | 1-(4-fluorophenyl)sulfonylazetidine-3-carboxylic acid |
| InChIKey | DIIBCOXATOTZJN-UHFFFAOYSA-N |
| SMILES | C1C(CN1S(=O)(=O)C2=CC=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)