CAS 866127-80-2 appears in our catalog under these names: UR778Br, UR778Br, 99.33%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 50mg, 100 mg, 10mM/1mL, 10 mg, 5 mg.
5-bromo-1-butyl-3-hydroxy-3-[2-(2-hydroxyphenyl)-2-oxoethyl]indol-2-one (CAS 866127-80-2) is a chemical compound with the molecular formula C20H20BrNO4 and a molecular weight of 418.3 g/mol. IUPAC name: 5-bromo-1-butyl-3-hydroxy-3-[2-(2-hydroxyphenyl)-2-oxoethyl]indol-2-one. InChIKey: JRUXICTUJPRUER-UHFFFAOYSA-N.
| Molecular formula | C20H20BrNO4 |
|---|---|
| Molecular weight | 418.3 g/mol |
| IUPAC name | 5-bromo-1-butyl-3-hydroxy-3-[2-(2-hydroxyphenyl)-2-oxoethyl]indol-2-one |
| InChIKey | JRUXICTUJPRUER-UHFFFAOYSA-N |
| SMILES | CCCCN1C2=C(C=C(C=C2)Br)C(C1=O)(CC(=O)C3=CC=CC=C3O)O |
Computed by PubChem (NCBI)