Products 866131-79-5
CAS 866131-79-5 is the registry number for 2-Chloro-n-(1,4,6-trimethyl-1h-pyrazolo[3,4-b]pyridin-3-yl)acetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-chloro-N-(1,4,6-trimethylpyrazolo[5,4-b]pyridin-3-yl)acetamide (CAS 866131-79-5) is a chemical compound with the molecular formula C11H13ClN4O and a molecular weight of 252.70 g/mol. IUPAC name: 2-chloro-N-(1,4,6-trimethylpyrazolo[5,4-b]pyridin-3-yl)acetamide. InChIKey: PXPTVPPDPSUFIP-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN4O |
|---|---|
| Molecular weight | 252.70 g/mol |
| IUPAC name | 2-chloro-N-(1,4,6-trimethylpyrazolo[5,4-b]pyridin-3-yl)acetamide |
| InChIKey | PXPTVPPDPSUFIP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=C1C(=NN2C)NC(=O)CCl)C |
Computed by PubChem (NCBI)