CAS 866134-42-1 appears in our catalog under these names: 6-Chloro-4-(methylsulfonyl)-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylic acid, 95%, 6-Chloro-4-methanesulfonyl-3,4-dihydro-2H-1,4-benzoxazine-2-carboxylic acid, 90%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
6-chloro-4-methylsulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid (CAS 866134-42-1) is a chemical compound with the molecular formula C10H10ClNO5S and a molecular weight of 291.71 g/mol. IUPAC name: 6-chloro-4-methylsulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid. InChIKey: DBLMTKDBFGZVBA-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNO5S |
|---|---|
| Molecular weight | 291.71 g/mol |
| IUPAC name | 6-chloro-4-methylsulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid |
| InChIKey | DBLMTKDBFGZVBA-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)N1CC(OC2=C1C=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)