CAS 866478-74-2 is the registry number for 1-({[(Benzyloxy)carbonyl]amino}amino)-2,2,2-trifluoroethanone, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Benzyl N-[(2,2,2-trifluoroacetyl)amino]carbamate (CAS 866478-74-2) is a chemical compound with the molecular formula C10H9F3N2O3 and a molecular weight of 262.18 g/mol. IUPAC name: benzyl N-[(2,2,2-trifluoroacetyl)amino]carbamate. InChIKey: ORLORBVOVFSZJZ-UHFFFAOYSA-N.
| Molecular formula | C10H9F3N2O3 |
|---|---|
| Molecular weight | 262.18 g/mol |
| IUPAC name | benzyl N-[(2,2,2-trifluoroacetyl)amino]carbamate |
| InChIKey | ORLORBVOVFSZJZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NNC(=O)C(F)(F)F |
Computed by PubChem (NCBI)