CAS 866555-95-5 appears in our catalog under these names: 5-(Difluoromethyl)-3-(4-nitrophenyl)-1,2,4-oxadiazole, 5-(Difluoromethyl)-3-(4-nitrophenyl)-1,2,4-oxadiazole, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 0,5g, 5g, 10g, 250mg, 1g, 100mg.
5-(difluoromethyl)-3-(4-nitrophenyl)-1,2,4-oxadiazole (CAS 866555-95-5) is a chemical compound with the molecular formula C9H5F2N3O3 and a molecular weight of 241.15 g/mol. IUPAC name: 5-(difluoromethyl)-3-(4-nitrophenyl)-1,2,4-oxadiazole. InChIKey: HWILFGCWJOJUHU-UHFFFAOYSA-N.
| Molecular formula | C9H5F2N3O3 |
|---|---|
| Molecular weight | 241.15 g/mol |
| IUPAC name | 5-(difluoromethyl)-3-(4-nitrophenyl)-1,2,4-oxadiazole |
| InChIKey | HWILFGCWJOJUHU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NOC(=N2)C(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)