CAS 866602-52-0 appears in our catalog under these names: Dodeca-2E,4E,8Z-Tetraenoic Acid Isobutylamide (10E/Z Mixture), Dodeca 2E,4E,8Z,10E,Z-tetraenoic acid isobutylamide - ca. 10 mg/ml acetonitrile solution, Dodeca-2E,4E,8Z,10Z/E-N-tetraenoic acid isobutylamide, 98.54%, Dodeca 2E,4E,8Z,10E,Z-tetraenoic acid is, obutylamide, 1 mg, Dodeca 2E,4E,8Z,10E,Z-tetraenoic acid is, obutylamide, 2 mg. Offered by: Chemat Brand, TRC, Biosynth, MedChemExpress, Roth. Available pack sizes: on request, 10mg, 1mg, 2mg, 5mg, 25mg, 1 mg (40.42 mM * 100 μL in Acetonitrile), 5 mg (40.42 mM * 500 μL in Acetonitrile).
(2E,4E,8Z,10Z)-N-(2-methylpropyl)dodeca-2,4,8,10-tetraenamide;(2E,4E,8Z,10E)-N-(2-methylpropyl)dodeca-2,4,8,10-tetraenamide (CAS 866602-52-0) is a chemical compound with the molecular formula C32H50N2O2 and a molecular weight of 494.8 g/mol. IUPAC name: (2E,4E,8Z,10Z)-N-(2-methylpropyl)dodeca-2,4,8,10-tetraenamide;(2E,4E,8Z,10E)-N-(2-methylpropyl)dodeca-2,4,8,10-tetraenamide. InChIKey: HWNSIBHUGIVNCH-WNBJYMDISA-N.
| Molecular formula | C32H50N2O2 |
|---|---|
| Molecular weight | 494.8 g/mol |
| IUPAC name | (2E,4E,8Z,10Z)-N-(2-methylpropyl)dodeca-2,4,8,10-tetraenamide;(2E,4E,8Z,10E)-N-(2-methylpropyl)dodeca-2,4,8,10-tetraenamide |
| InChIKey | HWNSIBHUGIVNCH-WNBJYMDISA-N |
| SMILES | C/C=C/C=C\CC/C=C/C=C/C(=O)NCC(C)C.C/C=C\C=C/CC/C=C/C=C/C(=O)NCC(C)C |
Computed by PubChem (NCBI)