CAS 866761-68-4 is the registry number for Prasugrel Impurity 39. Offered by: Chemat Brand. Available pack sizes: on request.
(2Z)-2-[(4S)-1-[(1S)-2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]acetic acid (CAS 866761-68-4) is a chemical compound with the molecular formula C18H20FNO3S and a molecular weight of 349.4 g/mol. IUPAC name: (2Z)-2-[(4S)-1-[(1S)-2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]acetic acid. InChIKey: ZWUQVNSJSJHFPS-UKGUVBINSA-N.
| Molecular formula | C18H20FNO3S |
|---|---|
| Molecular weight | 349.4 g/mol |
| IUPAC name | (2Z)-2-[(4S)-1-[(1S)-2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]acetic acid |
| InChIKey | ZWUQVNSJSJHFPS-UKGUVBINSA-N |
| SMILES | C1CN(C/C(=C/C(=O)O)/[C@H]1S)[C@@H](C2=CC=CC=C2F)C(=O)C3CC3 |
Computed by PubChem (NCBI)