Products 866768-15-2

CAS 866768-15-2 is the registry number for 3-Chloro-5-ethoxy-4-(2-ethoxy-2-oxoethoxy)benzoic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.

Structural formula: {0} (CAS {1})

3-chloro-5-ethoxy-4-(2-ethoxy-2-oxoethoxy)benzoic acid (CAS 866768-15-2) is a chemical compound with the molecular formula C13H15ClO6 and a molecular weight of 302.71 g/mol. IUPAC name: 3-chloro-5-ethoxy-4-(2-ethoxy-2-oxoethoxy)benzoic acid. InChIKey: LRZLGUZVDHSWNM-UHFFFAOYSA-N.

Identity
Molecular formulaC13H15ClO6
Molecular weight302.71 g/mol
IUPAC name3-chloro-5-ethoxy-4-(2-ethoxy-2-oxoethoxy)benzoic acid
InChIKeyLRZLGUZVDHSWNM-UHFFFAOYSA-N
SMILESCCOC1=C(C(=CC(=C1)C(=O)O)Cl)OCC(=O)OCC

Computed by PubChem (NCBI)