Products 866864-06-4
CAS 866864-06-4 appears in our catalog under these names: rac Mono(5-carboxy-2-ethylpentyl) Phthalate-d4, Mono(5–carboxy–2–ethylpentyl) phthalate–d4, Mono(5-carboxy-2-ethylpentyl) phthalate-d4. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 1 mg.
2-(5-carboxy-2-ethylpentoxy)carbonyl-3,4,5,6-tetradeuteriobenzoic acid (CAS 866864-06-4) is a chemical compound with the molecular formula C16H20O6 and a molecular weight of 312.35 g/mol. IUPAC name: 2-(5-carboxy-2-ethylpentoxy)carbonyl-3,4,5,6-tetradeuteriobenzoic acid. InChIKey: XFGRNAPKLGXDGF-KNIGXJNHSA-N.
| Molecular formula | C16H20O6 |
|---|---|
| Molecular weight | 312.35 g/mol |
| IUPAC name | 2-(5-carboxy-2-ethylpentoxy)carbonyl-3,4,5,6-tetradeuteriobenzoic acid |
| InChIKey | XFGRNAPKLGXDGF-KNIGXJNHSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)O)C(=O)OCC(CC)CCCC(=O)O)[2H])[2H] |
Computed by PubChem (NCBI)