CAS 866873-98-5 appears in our catalog under these names: Carbamazepine Impurity 8, Carbamazepine Impurity 10, 10,11-Dibromo-10,11-dihydro-5H-dibenzo(b,f)azepine-5-carbonyl Bromide. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 1g.
5,6-dibromo-5,6-dihydrobenzo[b][1]benzazepine-11-carbonyl bromide (CAS 866873-98-5) is a chemical compound with the molecular formula C15H10Br3NO and a molecular weight of 460.0 g/mol. IUPAC name: 5,6-dibromo-5,6-dihydrobenzo[b][1]benzazepine-11-carbonyl bromide. InChIKey: XJGIMRNXFBIKAU-UHFFFAOYSA-N.
| Molecular formula | C15H10Br3NO |
|---|---|
| Molecular weight | 460.0 g/mol |
| IUPAC name | 5,6-dibromo-5,6-dihydrobenzo[b][1]benzazepine-11-carbonyl bromide |
| InChIKey | XJGIMRNXFBIKAU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C(C3=CC=CC=C3N2C(=O)Br)Br)Br |
Computed by PubChem (NCBI)