CAS 867-81-2 appears in our catalog under these names: Sodium D-Pantothenate, D-Pantothenic Acid Sodium Salt, D-Pantothenic acid sodium, D-Pantothenic acid sodium/ 99.5% (existing batch purity), D–Pantothenic Acid (sodium salt). Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, TargetMol, GLPBio. Available pack sizes: on request, 2,5g, 250mg, 500mg, 1g, 100mg, 200mg, 100g.
Sodium 3-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]propanoate (CAS 867-81-2) is a chemical compound with the molecular formula C9H16NNaO5 and a molecular weight of 241.22 g/mol. IUPAC name: sodium 3-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]propanoate. InChIKey: GQTHJBOWLPZUOI-FJXQXJEOSA-M.
| Molecular formula | C9H16NNaO5 |
|---|---|
| Molecular weight | 241.22 g/mol |
| IUPAC name | sodium 3-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]propanoate |
| InChIKey | GQTHJBOWLPZUOI-FJXQXJEOSA-M |
| SMILES | CC(C)(CO)[C@H](C(=O)NCCC(=O)[O-])O.[Na+] |
Computed by PubChem (NCBI)