Products 867009-56-1

CAS 867009-56-1 is the registry number for 1-tert-Butyl 4-ethyl 4-(2-ethoxy-2-oxoethyl)piperidine-1,4-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

1-O-tert-butyl 4-O-ethyl 4-(2-ethoxy-2-oxoethyl)piperidine-1,4-dicarboxylate (CAS 867009-56-1) is a chemical compound with the molecular formula C17H29NO6 and a molecular weight of 343.4 g/mol. IUPAC name: 1-O-tert-butyl 4-O-ethyl 4-(2-ethoxy-2-oxoethyl)piperidine-1,4-dicarboxylate. InChIKey: SXZLSDSEEKQYPA-UHFFFAOYSA-N.

Identity
Molecular formulaC17H29NO6
Molecular weight343.4 g/mol
IUPAC name1-O-tert-butyl 4-O-ethyl 4-(2-ethoxy-2-oxoethyl)piperidine-1,4-dicarboxylate
InChIKeySXZLSDSEEKQYPA-UHFFFAOYSA-N
SMILESCCOC(=O)CC1(CCN(CC1)C(=O)OC(C)(C)C)C(=O)OCC

Computed by PubChem (NCBI)