CAS 867044-28-8 appears in our catalog under these names: Boronic acid, (9,10-di-2-naphthalenyl-2-anthracenyl)-, 95%, (9,10-Di(2-naphthyl)-2-anthryl)boronic acid, 95-<97%, (9,10–Di(naphthalen–2–yl)anthracen–2–yl)boronic acid, (9,10-Di(naphthalen-2-yl)anthracen-2-yl)boronic acid 95%, (9,10-Di(naphthalen-2-yl)anthracen-2-yl)boronic acid, 95%, 95%. Offered by: Combi-blocks, Hoffman Fine Chemicals, GLPBio, Ambeed, Chemat. Available pack sizes: 250mg, 5g, 1g, 50g, 100g, 200g, 300g, 400g.
(9,10-dinaphthalen-2-ylanthracen-2-yl)boronic acid (CAS 867044-28-8) is a chemical compound with the molecular formula C34H23BO2 and a molecular weight of 474.4 g/mol. IUPAC name: (9,10-dinaphthalen-2-ylanthracen-2-yl)boronic acid. InChIKey: NVPJWLBDGLWXCH-UHFFFAOYSA-N.
| Molecular formula | C34H23BO2 |
|---|---|
| Molecular weight | 474.4 g/mol |
| IUPAC name | (9,10-dinaphthalen-2-ylanthracen-2-yl)boronic acid |
| InChIKey | NVPJWLBDGLWXCH-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C3=CC=CC=C3C(=C2C=C1)C4=CC5=CC=CC=C5C=C4)C6=CC7=CC=CC=C7C=C6)(O)O |
Computed by PubChem (NCBI)