Products 86710-21-6
CAS 86710-21-6 is the registry number for MAO-B-IN-34. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-3-(3,4-dichlorophenyl)-1-(4-nitrophenyl)prop-2-en-1-one (CAS 86710-21-6) is a chemical compound with the molecular formula C15H9Cl2NO3 and a molecular weight of 322.1 g/mol. IUPAC name: (E)-3-(3,4-dichlorophenyl)-1-(4-nitrophenyl)prop-2-en-1-one. InChIKey: VBSFJEXNLVCUPB-KRXBUXKQSA-N.
| Molecular formula | C15H9Cl2NO3 |
|---|---|
| Molecular weight | 322.1 g/mol |
| IUPAC name | (E)-3-(3,4-dichlorophenyl)-1-(4-nitrophenyl)prop-2-en-1-one |
| InChIKey | VBSFJEXNLVCUPB-KRXBUXKQSA-N |
| SMILES | C1=CC(=CC=C1C(=O)/C=C/C2=CC(=C(C=C2)Cl)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)