CAS 867287-99-8 appears in our catalog under these names: 3-Fluoro-3'-methoxy-[1,1'-biphenyl]-4-amine, 95%, 95%, 3-Fluoro-3'-methoxy-[1,1'-biphenyl]-4-amine, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
2-fluoro-4-(3-methoxyphenyl)aniline (CAS 867287-99-8) is a chemical compound with the molecular formula C13H12FNO and a molecular weight of 217.24 g/mol. IUPAC name: 2-fluoro-4-(3-methoxyphenyl)aniline. InChIKey: VRDXXLMDZOTSRM-UHFFFAOYSA-N.
| Molecular formula | C13H12FNO |
|---|---|
| Molecular weight | 217.24 g/mol |
| IUPAC name | 2-fluoro-4-(3-methoxyphenyl)aniline |
| InChIKey | VRDXXLMDZOTSRM-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=CC(=C(C=C2)N)F |
Computed by PubChem (NCBI)